4463-33-6 2,3-Dimethoxytoluene |
|
Produkt-Name | 2,3-Dimethoxytoluene |
Englischer Name | 2,3-Dimethoxytoluene;3-Methylveratrole;1,2-dimethoxy-3-methylbenzene |
Molekulare Formel | C9H12O2 |
Molecular Weight | 152.1904 |
InChl | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
CAS Registry Number | 4463-33-6 |
EINECS | 224-726-4 |
Molecular Structure | |
Dichte | 0.99g/cm3 |
Siedepunkt | 201.4°C at 760 mmHg |
Brechungsindex | 1.489 |
Flammpunkt | 67.6°C |
Dampfdruck | 0.438mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Wenn Sie vorhaben, 2,3-Dimethoxytoluene 4463-33-6 aus China zu beziehen, gehen Sie einfach zum ChemNet-Einkaufszentrum, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall