ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-22-0 2'-fluoropropiophenone |
|
Produkt-Name | 2'-fluoropropiophenone |
Englischer Name | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
Molekulare Formel | C9H9FO |
Molecular Weight | 152.1656 |
InChl | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS Registry Number | 446-22-0 |
EINECS | 244-220-7 |
Molecular Structure | ![]() |
Dichte | 1.074g/cm3 |
Siedepunkt | 204.119°C at 760 mmHg |
Brechungsindex | 1.489 |
Flammpunkt | 77.067°C |
Dampfdruck | 0.268mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |