ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
443-33-4 2-Chloro-6-fluorobenzaldoxime |
|
Produkt-Name | 2-Chloro-6-fluorobenzaldoxime |
Englischer Name | 2-Chloro-6-fluorobenzaldoxime;2-Chloro-6-fluorobenzaldehyde oxime |
Molekulare Formel | C7H5ClFNO |
Molecular Weight | 173.5721 |
InChl | InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
CAS Registry Number | 443-33-4 |
EINECS | 207-135-6 |
Molecular Structure | |
Dichte | 1.32g/cm3 |
Schmelzpunkt | 133℃ |
Siedepunkt | 238°C at 760 mmHg |
Brechungsindex | 1.533 |
Flammpunkt | 97.8°C |
Dampfdruck | 0.0237mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |