ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha-Benzoin oxime |
|
Produkt-Name | alpha-Benzoin oxime |
Englischer Name | alpha-Benzoin oxime;2-Hydroxy-1,2-diphenylethanone oxime (alpha-form);a-Benzoin oxime, (Cupron);(1E)-2-hydroxy-1,2-diphenylethanone oxime;(1Z)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1E,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime;α-Benzoin oxime;Benzoin α-oxime |
Molekulare Formel | C14H13NO2 |
Molecular Weight | 227.2585 |
InChl | InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 |
CAS Registry Number | 441-38-3 |
EINECS | 207-127-2 |
Molecular Structure | |
Dichte | 1.13g/cm3 |
Schmelzpunkt | 150-155℃ |
Siedepunkt | 417.8°C at 760 mmHg |
Brechungsindex | 1.58 |
Flammpunkt | 270.4°C |
Dampfdruck | 9.98E-08mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |