ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
423768-55-2 (2-Morpholino-3-pyridinyl)methanol |
|
Produkt-Name | (2-Morpholino-3-pyridinyl)methanol |
Synonyme | (2-Morpholin-4-ylpyridin-3-yl)methanol; |
Englischer Name | (2-morpholino-3-pyridinyl)methanol;(2-morpholin-4-ylpyridin-3-yl)methanol |
Molekulare Formel | C10H14N2O2 |
Molecular Weight | 194.2304 |
InChl | InChI=1/C10H14N2O2/c13-8-9-2-1-3-11-10(9)12-4-6-14-7-5-12/h1-3,13H,4-8H2 |
CAS Registry Number | 423768-55-2 |
Molecular Structure | |
Dichte | 1.215g/cm3 |
Schmelzpunkt | 78℃ |
Siedepunkt | 397°C at 760 mmHg |
Brechungsindex | 1.572 |
Flammpunkt | 193.9°C |
Dampfdruck | 5.15E-07mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |