ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4096-21-3 1-Phenylpyrrolidine |
|
Produkt-Name | 1-Phenylpyrrolidine |
Englischer Name | 1-Phenylpyrrolidine;1-phenyl-pyrrolidine |
Molekulare Formel | C10H13N |
Molecular Weight | 147.2169 |
InChl | InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
CAS Registry Number | 4096-21-3 |
EINECS | 223-849-0 |
Molecular Structure | |
Dichte | 1.022g/cm3 |
Siedepunkt | 237.8°C at 760 mmHg |
Brechungsindex | 1.558 |
Flammpunkt | 89°C |
Dampfdruck | 0.0439mmHg at 25°C |
Risk Codes | R21/22##Harmful in contact with skin and if swallowed.:; |
Safety Beschreibung | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |