ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Fluoro-DL-tyrosine |
|
Produkt-Name | 3-Fluoro-DL-tyrosine |
Englischer Name | 3-Fluoro-DL-tyrosine;H-DL-Tyr(3-F)-OH |
Molekulare Formel | C9H10FNO3 |
Molecular Weight | 199.179 |
InChl | InChI=1/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
CAS Registry Number | 403-90-7 |
EINECS | 206-964-0 |
Molecular Structure | |
Dichte | 1.421g/cm3 |
Schmelzpunkt | 276-280℃ |
Siedepunkt | 362.4°C at 760 mmHg |
Brechungsindex | 1.591 |
Flammpunkt | 172.9°C |
Dampfdruck | 6.94E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |