ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
Produkt-Name | 1-(3-fluorophenyl)ethanol |
Englischer Name | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
Molekulare Formel | C8H9FO |
Molecular Weight | 140.1549 |
InChl | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
CAS Registry Number | 402-63-1 |
EINECS | 206-950-4 |
Molecular Structure | ![]() |
Dichte | 1.123g/cm3 |
Siedepunkt | 196.2°C at 760 mmHg |
Brechungsindex | 1.51 |
Flammpunkt | 90.1°C |
Dampfdruck | 0.251mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |