ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
Produkt-Name | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
Englischer Name | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
Molekulare Formel | C6H7NO2S |
Molecular Weight | 157.1903 |
InChl | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
CAS Registry Number | 39978-14-8 |
Molecular Structure | |
Dichte | 1.319g/cm3 |
Schmelzpunkt | 203℃ |
Siedepunkt | 295.9°C at 760 mmHg |
Brechungsindex | 1.598 |
Flammpunkt | 132.8°C |
Dampfdruck | 0.00148mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |