ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38690-76-5 4-Cyanophenyl-4-heptylbenzoat |
|
Produkt-Name | 4-Cyanophenyl-4-heptylbenzoat |
Synonyme | 4-n-Heptylbenzoesäure-4-Cyanophenylester; |
Englischer Name | 4-Cyanophenyl 4-heptylbenzoate;4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
Molekulare Formel | C21H23NO2 |
Molecular Weight | 321.4128 |
InChl | InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
CAS Registry Number | 38690-76-5 |
EINECS | 254-084-0 |
Molecular Structure | |
Dichte | 1.09g/cm3 |
Schmelzpunkt | 43-45℃ |
Siedepunkt | 476.4°C at 760 mmHg |
Brechungsindex | 1.56 |
Flammpunkt | 238.3°C |
Dampfdruck | 3.07E-09mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |