ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35450-36-3 Methyl 2-bromo-5-methoxybenzoate |
|
Produkt-Name | Methyl 2-bromo-5-methoxybenzoate |
Englischer Name | Methyl 2-bromo-5-methoxybenzoate;2-Bromo-5-methoxybenzoic acid methyl ester |
Molekulare Formel | C9H9BrO3 |
Molecular Weight | 245.07 |
InChl | InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
CAS Registry Number | 35450-36-3 |
Molecular Structure | |
Dichte | 1.462g/cm3 |
Siedepunkt | 291.9°C at 760 mmHg |
Brechungsindex | 1.537 |
Flammpunkt | 130.4°C |
Dampfdruck | 0.00189mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |