ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
350-90-3 Alpha-Fluorocinnamic acid |
|
Produkt-Name | Alpha-Fluorocinnamic acid |
Englischer Name | Alpha-Fluorocinnamic acid;Cinnamic acid, alpha-fluoro-;1-09-00-00237 (Beilstein Handbook Reference);2-Fluoro-3-phenyl-2-propenoic acid;BRN 2501318;NSC 102780;alpha-Fluorocinnamic acid;2-Propenoic acid, 2-fluoro-3-phenyl- (9CI);2-fluoro-3-phenylprop-2-enoic acid;(2Z)-2-fluoro-3-phenylprop-2-enoate;(2Z)-2-fluoro-3-phenylprop-2-enoic acid |
Molekulare Formel | C9H7FO2 |
Molecular Weight | 166.1491 |
InChl | InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- |
CAS Registry Number | 350-90-3 |
EINECS | 206-508-0 |
Molecular Structure | ![]() |
Dichte | 1.275g/cm3 |
Schmelzpunkt | 156-160℃ |
Siedepunkt | 289.3°C at 760 mmHg |
Brechungsindex | 1.585 |
Flammpunkt | 128.7°C |
Dampfdruck | 0.00103mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |