3469-26-9 2,7-Dimethoxynaphthalene |
Produkt-Name |
2,7-Dimethoxynaphthalene |
Englischer Name |
2,7-Dimethoxynaphthalene;2,7-dimethoxyl Naphthalene |
Molekulare Formel |
C12H12O2 |
Molecular Weight |
188.2225 |
InChl |
InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
CAS Registry Number |
3469-26-9 |
EINECS |
222-433-6 |
Molecular Structure |
|
Dichte |
1.097g/cm3 |
Schmelzpunkt |
137-139℃ |
Siedepunkt |
311.2°C at 760 mmHg |
Brechungsindex |
1.584 |
Flammpunkt |
130.3°C |
Dampfdruck |
0.00105mmHg at 25°C |
Safety Beschreibung |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |