ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3469-26-9 2,7-Dimethoxynaphthalene |
|
Produkt-Name | 2,7-Dimethoxynaphthalene |
Englischer Name | 2,7-Dimethoxynaphthalene;2,7-dimethoxyl Naphthalene |
Molekulare Formel | C12H12O2 |
Molecular Weight | 188.2225 |
InChl | InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
CAS Registry Number | 3469-26-9 |
EINECS | 222-433-6 |
Molecular Structure | |
Dichte | 1.097g/cm3 |
Schmelzpunkt | 137-139℃ |
Siedepunkt | 311.2°C at 760 mmHg |
Brechungsindex | 1.584 |
Flammpunkt | 130.3°C |
Dampfdruck | 0.00105mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |