ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone |
|
Produkt-Name | 3,3'-difluorobenzophenone |
Englischer Name | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
Molekulare Formel | C13H8F2O |
Molecular Weight | 218.1988 |
InChl | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS Registry Number | 345-70-0 |
Molecular Structure | |
Dichte | 1.239g/cm3 |
Schmelzpunkt | 56-59℃ |
Siedepunkt | 316.2°C at 760 mmHg |
Brechungsindex | 1.549 |
Flammpunkt | 121.3°C |
Dampfdruck | 0.000415mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |