ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate |
|
Produkt-Name | dimethyl fluoromalonate |
Englischer Name | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
Molekulare Formel | C5H7FO4 |
Molecular Weight | 150.1051 |
InChl | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS Registry Number | 344-14-9 |
Molecular Structure | ![]() |
Dichte | 1.211g/cm3 |
Siedepunkt | 140.3°C at 760 mmHg |
Brechungsindex | 1.382 |
Flammpunkt | 38.4°C |
Dampfdruck | 6.18mmHg at 25°C |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |