Chemindex > 343-27-1
DE ▼
Harmine hydrochloride hydrate |
|
| Produkt-Name | Harmine hydrochloride hydrate |
| Englischer Name | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride |
| Molekulare Formel | C13H13ClN2O |
| Molecular Weight | 248.7081 |
| InChl | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| CAS Registry Number | 343-27-1 |
| EINECS | 206-443-8 |
| Molecular Structure |  |
| Schmelzpunkt | 265-270℃ |
| Siedepunkt | 421.4°C at 760 mmHg |
| Flammpunkt | 139.8°C |
| Dampfdruck | 6.42E-07mmHg at 25°C |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R40##Possible risks of irreversible effects.:; |
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 