ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343-27-1 Harmine hydrochloride hydrate |
|
Produkt-Name | Harmine hydrochloride hydrate |
Englischer Name | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride |
Molekulare Formel | C13H13ClN2O |
Molecular Weight | 248.7081 |
InChl | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
CAS Registry Number | 343-27-1 |
EINECS | 206-443-8 |
Molecular Structure | ![]() |
Schmelzpunkt | 265-270℃ |
Siedepunkt | 421.4°C at 760 mmHg |
Flammpunkt | 139.8°C |
Dampfdruck | 6.42E-07mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R40##Possible risks of irreversible effects.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |