Chemindex > 341-69-5
DE ▼
341-69-5 Orphenadrine hydrochloride |
|
| Produkt-Name | Orphenadrine hydrochloride |
| Englischer Name | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| Molekulare Formel | C18H24NO |
| Molecular Weight | 270.3887 |
| InChl | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| CAS Registry Number | 341-69-5 |
| EINECS | 206-435-4 |
| Molecular Structure |  |
| Schmelzpunkt | 159-162℃ |
| Siedepunkt | 363°C at 760 mmHg |
| Flammpunkt | 107.1°C |
| Dampfdruck | 1.86E-05mmHg at 25°C |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R20/21##Harmful by inhalation and in contact with skin.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 