ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
Produkt-Name | 3-fluoro-4-methoxybenzonitrile |
Englischer Name | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
Molekulare Formel | C8H6FNO |
Molecular Weight | 151.1377 |
InChl | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS Registry Number | 331-62-4 |
Molecular Structure | |
Dichte | 1.18g/cm3 |
Siedepunkt | 254.3°C at 760 mmHg |
Brechungsindex | 1.505 |
Flammpunkt | 107.6°C |
Dampfdruck | 0.0173mmHg at 25°C |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |