ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
324-42-5 2-Fluor-6-methylnaphthalin |
|
Produkt-Name | 2-Fluor-6-methylnaphthalin |
Englischer Name | 2-fluoro-6-methylnaphthalene; |
Molekulare Formel | C11H9F |
Molecular Weight | 160.1876 |
InChl | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
CAS Registry Number | 324-42-5 |
Molecular Structure | |
Dichte | 1.112g/cm3 |
Schmelzpunkt | 72℃ |
Siedepunkt | 247.5°C at 760 mmHg |
Brechungsindex | 1.594 |
Flammpunkt | 84.5°C |
Dampfdruck | 0.0403mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |