ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31874-34-7 2,4-Dimethoxybenzaldoxime |
|
Produkt-Name | 2,4-Dimethoxybenzaldoxime |
Englischer Name | 2,4-Dimethoxybenzaldoxime;1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine;2,4-dimethoxybenzaldehyde oxime |
Molekulare Formel | C9H11NO3 |
Molecular Weight | 181.1885 |
InChl | InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
CAS Registry Number | 31874-34-7 |
Molecular Structure | |
Dichte | 1.11g/cm3 |
Siedepunkt | 304.9°C at 760 mmHg |
Brechungsindex | 1.501 |
Flammpunkt | 138.2°C |
Dampfdruck | 0.000372mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |