ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-90-0 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamid |
|
Produkt-Name | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamid |
Englischer Name | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide; |
Molekulare Formel | C11H9N3O3S |
Molecular Weight | 263.2725 |
InChl | InChI=1/C11H9N3O3S/c12-10(15)5-11-13-9(6-18-11)7-1-3-8(4-2-7)14(16)17/h1-4,6H,5H2,(H2,12,15) |
CAS Registry Number | 306935-90-0 |
Molecular Structure | ![]() |
Dichte | 1.439g/cm3 |
Schmelzpunkt | 202℃ |
Siedepunkt | 524.9°C at 760 mmHg |
Brechungsindex | 1.653 |
Flammpunkt | 271.3°C |
Dampfdruck | 4.11E-11mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |