Chemindex > 306-37-6
DE ▼
306-37-6 sym-Dimethylhydrazine dihydrochloride |
|
| Produkt-Name | sym-Dimethylhydrazine dihydrochloride |
| Englischer Name | sym-Dimethylhydrazine dihydrochloride;1,2-Dimethylhydrazine dihydrochloride;1,2-dimethylhydrazine;1,1-dimethylhydrazine dihydrochloride |
| Molekulare Formel | C2H10Cl2N2 |
| Molecular Weight | 133.0202 |
| InChl | InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
| CAS Registry Number | 306-37-6 |
| EINECS | 206-183-5 |
| Molecular Structure |  |
| Schmelzpunkt | 166-167℃ |
| Siedepunkt | 63.9°C at 760 mmHg |
| Flammpunkt | 1.1°C |
| Dampfdruck | 168mmHg at 25°C |
| Gefahrensymbole |  T##Toxic:; |
| Risk Codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R45##May cause cancer.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 306-37-6 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 