Chemindex > 305-53-3
DE ▼
305-53-3 Iodoacetic acid, sodium salt |
|
| Produkt-Name | Iodoacetic acid, sodium salt |
| Englischer Name | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
| Molekulare Formel | C2H2INaO2 |
| Molecular Weight | 207.9303 |
| InChl | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS Registry Number | 305-53-3 |
| EINECS | 206-165-7 |
| Molecular Structure |  |
| Schmelzpunkt | 208-210℃ |
| Siedepunkt | 262.1°C at 760 mmHg |
| Flammpunkt | 112.3°C |
| Dampfdruck | 0.00329mmHg at 25°C |
| Gefahrensymbole |  T##Toxic:; |
| Risk Codes | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 