ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
methyl linolenate |
|
Produkt-Name | methyl linolenate |
Englischer Name | methyl linolenate; |
Molekulare Formel | C19H32O2 |
Molecular Weight | 292.4562 |
InChl | InChI=1/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
CAS Registry Number | 301-00-8 |
EINECS | 206-102-3 |
Molecular Structure | |
Dichte | 0.895g/cm3 |
Siedepunkt | 364.4°C at 760 mmHg |
Brechungsindex | 1.475 |
Flammpunkt | 101.4°C |
Dampfdruck | 1.69E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |