Chemindex > 300-08-3
DE ▼
Arecoline hydrobromide |
|
| Produkt-Name | Arecoline hydrobromide |
| Englischer Name | Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide;methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1);1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide;Arecoline HBr |
| Molekulare Formel | C8H14BrNO2 |
| Molecular Weight | 236.1063 |
| InChl | InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
| CAS Registry Number | 300-08-3 |
| EINECS | 206-087-3 |
| Molecular Structure |  |
| Schmelzpunkt | 171-174℃ |
| Siedepunkt | 209°C at 760 mmHg |
| Flammpunkt | 81.1°C |
| Dampfdruck | 0.208mmHg at 25°C |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R22:; |
| Safety Beschreibung | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 