Chemindex > 29425-97-6
DE ▼
29425-97-6 Decansäure, Verbindung mit Dibutylamin (1:1) |
|
| Produkt-Name | Decansäure, Verbindung mit Dibutylamin (1:1) |
| Synonyme | Decansäure, kompatibel mit N-Butyl-1-butanamin (1:1); Dibutylamin, Decansäuresalz; Decansäure, Verbindung mit Dibutylamin (1:1); Decansäure - N-Butylbutan-1-amin (1:1); |
| Englischer Name | decanoic acid, compound with dibutylamine (1:1);Decanoic acid, compd. with N-butyl-1-butanamine (1:1);Dibutylamine, decanoic acid salt;Decanoic acid, compound with dibutylamine (1:1);decanoic acid - N-butylbutan-1-amine (1:1) |
| Molekulare Formel | C18H39NO2 |
| Molecular Weight | 301.5078 |
| InChl | InChI=1/C10H20O2.C8H19N/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-5-7-9-8-6-4-2/h2-9H2,1H3,(H,11,12);9H,3-8H2,1-2H3 |
| CAS Registry Number | 29425-97-6 |
| EINECS | 249-620-5 |
| Molecular Structure |  |
| Siedepunkt | 269.6°C at 760 mmHg |
| Flammpunkt | 121.8°C |
| Dampfdruck | 0.00355mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 29425-97-6 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 