ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cyclododecane epoxide |
|
Produkt-Name | Cyclododecane epoxide |
Englischer Name | Cyclododecane epoxide;Cyclododecane epoxide, mixture of cis andtrans isomers;Cyclododecene oxide (cis+trans);Cyclododecane oxide;Epoxy N-Dodecane;13-oxabicyclo[10.1.0]tridecane;(1R,12R)-13-oxabicyclo[10.1.0]tridecane;(1R,12S)-13-oxabicyclo[10.1.0]tridecane;(1S,12S)-13-oxabicyclo[10.1.0]tridecane |
Molekulare Formel | C12H22O |
Molecular Weight | 182.3025 |
InChl | InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
CAS Registry Number | 286-99-7 |
EINECS | 206-012-4 |
Molecular Structure | |
Dichte | 0.899g/cm3 |
Schmelzpunkt | -7℃ |
Siedepunkt | 237.4°C at 760 mmHg |
Brechungsindex | 1.455 |
Flammpunkt | 82.2°C |
Dampfdruck | 0.0691mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R38:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |