ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Acridine |
|
Produkt-Name | Acridine |
Englischer Name | Acridine;Dibenzo[b,e]pyridine |
Molekulare Formel | C13H9N |
Molecular Weight | 179.2173 |
InChl | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
CAS Registry Number | 260-94-6 |
EINECS | 205-971-6 |
Molecular Structure | |
Dichte | 1.187g/cm3 |
Schmelzpunkt | 105-110℃ |
Siedepunkt | 346.7°C at 760 mmHg |
Brechungsindex | 1.726 |
Flammpunkt | 153.8°C |
Dampfdruck | 0.000113mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |