ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Norharman |
|
Produkt-Name | Norharman |
Englischer Name | Norharman;9H-Pyrido[3,4-B]Indole |
Molekulare Formel | C11H8N2 |
Molecular Weight | 168.1946 |
InChl | InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
CAS Registry Number | 244-63-3 |
EINECS | 205-959-0 |
Molecular Structure | |
Dichte | 1.301g/cm3 |
Schmelzpunkt | 198-202℃ |
Siedepunkt | 391.3°C at 760 mmHg |
Brechungsindex | 1.784 |
Flammpunkt | 182.1°C |
Dampfdruck | 5.62E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |