ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Benzofluorene |
|
Produkt-Name | 2,3-Benzofluorene |
Englischer Name | 2,3-Benzofluorene;11H-Benzo[b]fluorene;benzo(b)fluorene |
Molekulare Formel | C17H12 |
Molecular Weight | 216.2772 |
InChl | InChI=1/C17H12/c1-2-6-13-11-17-15(9-12(13)5-1)10-14-7-3-4-8-16(14)17/h1-9,11H,10H2 |
CAS Registry Number | 243-17-4 |
EINECS | 205-952-2 |
Molecular Structure | |
Dichte | 1.185g/cm3 |
Schmelzpunkt | 206-214℃ |
Siedepunkt | 398.3°C at 760 mmHg |
Brechungsindex | 1.714 |
Flammpunkt | 185.4°C |
Dampfdruck | 3.43E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |