ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24171-89-9 Tris(2-thienyl)phosphine |
|
Produkt-Name | Tris(2-thienyl)phosphine |
Englischer Name | Tris(2-thienyl)phosphine;Tri(2-thienyl)phosphine;trithiophen-2-ylphosphane |
Molekulare Formel | C12H9PS3 |
Molecular Weight | 280.3686 |
InChl | InChI=1/C12H9PS3/c1-4-10(14-7-1)13(11-5-2-8-15-11)12-6-3-9-16-12/h1-9H |
CAS Registry Number | 24171-89-9 |
EINECS | 246-059-8 |
Molecular Structure | ![]() |
Schmelzpunkt | 29-30℃ |
Siedepunkt | 375.8°C at 760 mmHg |
Flammpunkt | 181.1°C |
Dampfdruck | 1.64E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |