ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
239-35-0 1,2-benzodiphenylene sulfide |
|
Produkt-Name | 1,2-benzodiphenylene sulfide |
Englischer Name | 1,2-benzodiphenylene sulfide;11-thiabenzo(a)fluorene;1,2-benzo-9-thiafluorene;naphtho(1,2:2,3)thionaphthen;benzo[b]naphtho[2,1-d]thiophene |
Molekulare Formel | C16H10S |
Molecular Weight | 234.3156 |
InChl | InChI=1/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H |
CAS Registry Number | 239-35-0 |
EINECS | 205-948-0 |
Molecular Structure | ![]() |
Dichte | 1.292g/cm3 |
Schmelzpunkt | 188-190℃ |
Siedepunkt | 434.3°C at 760 mmHg |
Brechungsindex | 1.809 |
Flammpunkt | 163°C |
Dampfdruck | 2.44E-07mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |