ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
Produkt-Name | Phenanthridine |
Englischer Name | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
Molekulare Formel | C13H9N |
Molecular Weight | 179.2173 |
InChl | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS Registry Number | 229-87-8 |
EINECS | 205-934-4 |
Molecular Structure | |
Dichte | 1.187g/cm3 |
Schmelzpunkt | 104-107℃ |
Siedepunkt | 340.8°C at 760 mmHg |
Brechungsindex | 1.726 |
Flammpunkt | 155.9°C |
Dampfdruck | 0.000166mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R40##Possible risks of irreversible effects.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |