ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220497-88-1 (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentanhydrochlorid |
|
Produkt-Name | (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentanhydrochlorid |
Synonyme | (1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentanaminium; |
Englischer Name | (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentane hydrochloride;(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentanaminium |
Molekulare Formel | C6H14NO3 |
Molecular Weight | 148.1797 |
InChl | InChI=1/C6H13NO3/c7-4-1-3(2-8)5(9)6(4)10/h3-6,8-10H,1-2,7H2/p+1/t3-,4-,5-,6+/m0/s1 |
CAS Registry Number | 220497-88-1 |
Molecular Structure | ![]() |
Schmelzpunkt | 125.4℃ |
Siedepunkt | 300.855°C at 760 mmHg |
Flammpunkt | 135.752°C |
Dampfdruck | 0mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |