ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20948-66-7 5-(benzyloxy)-1H-indole-2-carbohydrazide |
|
Produkt-Name | 5-(benzyloxy)-1H-indole-2-carbohydrazide |
Englischer Name | 5-(benzyloxy)-1H-indole-2-carbohydrazide; |
Molekulare Formel | C16H15N3O2 |
Molecular Weight | 281.3092 |
InChl | InChI=1/C16H15N3O2/c17-19-16(20)15-9-12-8-13(6-7-14(12)18-15)21-10-11-4-2-1-3-5-11/h1-9,18H,10,17H2,(H,19,20) |
CAS Registry Number | 20948-66-7 |
Molecular Structure | |
Dichte | 1.313g/cm3 |
Schmelzpunkt | 219℃ |
Brechungsindex | 1.694 |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |