Chemindex > 18738-11-9
DE ▼
18738-11-9 12-Hydroxyolsäure, Verbindung mit 2-Aminoethanol (1:1) |
|
| Produkt-Name | 12-Hydroxyolsäure, Verbindung mit 2-Aminoethanol (1:1) |
| Synonyme | 9-Octadecensäure, 12-Hydroxy-, (9Z,12R)-, komp.mit 2-Aminoethanol (1:1); Acide 12-hydroxyoléique, Zusammensetzung avec 2-Aminoéthanol (1:1); Ricinolsäure, Monoethanolamin-Salz; 12-Hydroxyolsäure, Verbindung mit 2-Aminoethanol (1:1); (9Z,12R)-12-Hydroxyoctadec-9-ensäure-2-aminoethanol (1:1); |
| Englischer Name | 12-hydroxyoleic acid, compound with 2-aminoethanol (1:1);9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with 2-aminoethanol (1:1);Acide 12-hydroxyoléique, compose avec 2-aminoéthanol (1:1);Ricinoleic acid, monoethanolamine-salt;12-Hydroxyoleic acid, compound with 2-aminoethanol (1:1);(9Z,12R)-12-hydroxyoctadec-9-enoic acid - 2-aminoethanol (1:1) |
| Molekulare Formel | C20H41NO4 |
| Molecular Weight | 359.5438 |
| InChl | InChI=1/C18H34O3.C2H7NO/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;3-1-2-4/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4H,1-3H2/b12-9-;/t17-;/m1./s1 |
| CAS Registry Number | 18738-11-9 |
| EINECS | 242-546-4 |
| Molecular Structure |  |
| Siedepunkt | 416.4°C at 760 mmHg |
| Flammpunkt | 219.8°C |
| Dampfdruck | 1.12E-08mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 18738-11-9 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 