ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
15467-20-6 Nitrilotriacetic acid, disodium salt |
|
Produkt-Name | Nitrilotriacetic acid, disodium salt |
Englischer Name | Nitrilotriacetic acid, disodium salt;disodium hydrogen nitrilotriacetate;disodium [(carboxylatomethyl)(carboxymethyl)amino]acetate;2,2'-[(carboxymethyl)imino]diacetate (non-preferred name);acetate, 2,2',2''-nitrilotris-, sodium salt (1:2) |
Molekulare Formel | C6H6NNa2O6 |
Molecular Weight | 234.095 |
InChl | InChI=1/C6H9NO6.2Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-3 |
CAS Registry Number | 15467-20-6 |
EINECS | 239-484-5 |
Molecular Structure | ![]() |
Schmelzpunkt | 300℃ |
Gefahrensymbole | |
Risk Codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |