Chemindex > 15467-20-6
DE ▼
15467-20-6 Nitrilotriacetic acid, disodium salt |
|
| Produkt-Name | Nitrilotriacetic acid, disodium salt |
| Englischer Name | Nitrilotriacetic acid, disodium salt;disodium hydrogen nitrilotriacetate;disodium [(carboxylatomethyl)(carboxymethyl)amino]acetate;2,2'-[(carboxymethyl)imino]diacetate (non-preferred name);acetate, 2,2',2''-nitrilotris-, sodium salt (1:2) |
| Molekulare Formel | C6H6NNa2O6 |
| Molecular Weight | 234.095 |
| InChl | InChI=1/C6H9NO6.2Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-3 |
| CAS Registry Number | 15467-20-6 |
| EINECS | 239-484-5 |
| Molecular Structure |  |
| Schmelzpunkt | 300℃ |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 15467-20-6 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 