ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14580-28-0 4-(2-Chlorphenyl)semicarbazid |
|
Produkt-Name | 4-(2-Chlorphenyl)semicarbazid |
Synonyme | 1-(2-Chlorphenyl)semicarbazid; N-(2-Chlorphenyl)hydrazincarboxamid; |
Englischer Name | 4-(2-Chlorophenyl)semicarbazide;1-(2-Chlorophenyl)semicarbazide;N-(2-chlorophenyl)hydrazinecarboxamide |
Molekulare Formel | C7H8ClN3O |
Molecular Weight | 185.6109 |
InChl | InChI=1/C7H8ClN3O/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS Registry Number | 14580-28-0 |
Molecular Structure | |
Dichte | 1.422g/cm3 |
Brechungsindex | 1.655 |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |