ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-73-7 2-Acetyl-4-methylthiophene |
|
Produkt-Name | 2-Acetyl-4-methylthiophene |
Englischer Name | 2-Acetyl-4-methylthiophene;1-(4-Methyl-2-thienyl)ethan-1-one;AI3-61742;Ethanone, 1-(4-methyl-2-thienyl)-;1-(4-methylthiophen-2-yl)ethanone |
Molekulare Formel | C7H8OS |
Molecular Weight | 140.2028 |
InChl | InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
CAS Registry Number | 13679-73-7 |
EINECS | 237-180-7 |
Molecular Structure | |
Dichte | 1.106g/cm3 |
Siedepunkt | 236.9°C at 760 mmHg |
Brechungsindex | 1.535 |
Flammpunkt | 97.1°C |
Dampfdruck | 0.0461mmHg at 25°C |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |