ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-72-6 2-acetyl-3-methylthiophene |
|
Produkt-Name | 2-acetyl-3-methylthiophene |
Englischer Name | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
Molekulare Formel | C7H8OS |
Molecular Weight | 140.2028 |
InChl | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
CAS Registry Number | 13679-72-6 |
EINECS | 237-179-1 |
Molecular Structure | |
Dichte | 1.106g/cm3 |
Siedepunkt | 214.9°C at 760 mmHg |
Brechungsindex | 1.535 |
Flammpunkt | 92.3°C |
Dampfdruck | 0.152mmHg at 25°C |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |