ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
132747-20-7 (1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide |
|
Produkt-Name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide |
Englischer Name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide;(1S,4S)-2,5-Diazabicyclo(2.2.1)heptane.2HBr;(1S,2S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide;(1S,4S)-(+)-2,5-diazabicyclo [2,2,1]heptane dihydrobromide;2,5-diazabicyclo[2.2.1]heptane dihydrobromide |
Molekulare Formel | C5H12Br2N2 |
Molecular Weight | 259.9702 |
InChl | InChI=1/C5H10N2.2BrH/c1-4-2-6-5(1)3-7-4;;/h4-7H,1-3H2;2*1H |
CAS Registry Number | 132747-20-7 |
Molecular Structure | ![]() |
Schmelzpunkt | 300 °C |
Siedepunkt | 261.8°C at 760 mmHg |
Flammpunkt | 112.1°C |
Dampfdruck | 0.00765mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |