ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-80-8 Methyl 2-nonynoate |
|
Produkt-Name | Methyl 2-nonynoate |
Englischer Name | Methyl 2-nonynoate;2-Nonynoic acid methyl ester;2-Nonynoic acid, methyl ester;Methyl octin carbonate;Methyl octine carbonate;Octynecarboxylic acid, methyl ester;methyl non-2-ynoate |
Molekulare Formel | C10H16O2 |
Molecular Weight | 168.2328 |
InChl | InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
CAS Registry Number | 111-80-8 |
EINECS | 203-909-2 |
Molecular Structure | |
Dichte | 0.932g/cm3 |
Siedepunkt | 233.1°C at 760 mmHg |
Brechungsindex | 1.446 |
Flammpunkt | 100.6°C |
Dampfdruck | 0.0568mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |