ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromolauric acid |
|
Produkt-Name | 2-Bromolauric acid |
Englischer Name | 2-Bromolauric acid;2-Bromododecanoic acid |
Molekulare Formel | C12H23BrO2 |
Molecular Weight | 279.2138 |
InChl | InChI=1/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15) |
CAS Registry Number | 111-56-8 |
EINECS | 203-882-7 |
Molecular Structure | |
Dichte | 1.189g/cm3 |
Schmelzpunkt | 30-32℃ |
Siedepunkt | 344.8°C at 760 mmHg |
Brechungsindex | 1.481 |
Flammpunkt | 162.3°C |
Dampfdruck | 1.15E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |