Chemindex > 110-49-6
DE ▼
2-Methoxyethyl acetate |
|
| Produkt-Name | 2-Methoxyethyl acetate |
| Englischer Name | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| Molekulare Formel | C4H8O2S |
| Molecular Weight | 120.1701 |
| InChl | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| CAS Registry Number | 110-49-6 |
| EINECS | 203-772-9 |
| Molecular Structure |  |
| Dichte | 1.072g/cm3 |
| Schmelzpunkt | -65℃ |
| Siedepunkt | 162.7°C at 760 mmHg |
| Brechungsindex | 1.452 |
| Flammpunkt | 57.6°C |
| Dampfdruck | 2.14mmHg at 25°C |
| Gefahrensymbole |  T##Toxic:; |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| Safety Beschreibung | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 