ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl caprate |
|
Produkt-Name | Methyl caprate |
Englischer Name | Methyl caprate;Methyl decanoate;Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate;METHYLE N-CAPRINATE |
Molekulare Formel | C11H22O2 |
Molecular Weight | 186.2912 |
InChl | InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
CAS Registry Number | 110-42-9 |
EINECS | 203-766-6 |
Molecular Structure | |
Dichte | 0.872g/cm3 |
Schmelzpunkt | -11--14℃ |
Siedepunkt | 224°C at 760 mmHg |
Brechungsindex | 1.426 |
Flammpunkt | 94.4°C |
Dampfdruck | 0.0934mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |