ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Methylundecanal |
|
Produkt-Name | 2-Methylundecanal |
Englischer Name | 2-Methylundecanal; |
Molekulare Formel | C12H22O |
Molecular Weight | 182.3025 |
InChl | InChI=1/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h10-11H,3-9H2,1-2H3 |
CAS Registry Number | 110-41-8 |
EINECS | 203-765-0 |
Molecular Structure | |
Dichte | 0.838g/cm3 |
Siedepunkt | 262.7°C at 760 mmHg |
Brechungsindex | 1.443 |
Flammpunkt | 81.4°C |
Dampfdruck | 0.0107mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |