ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Succinamide |
|
Produkt-Name | Succinamide |
Englischer Name | Succinamide;Butanediamide;Succinic diamide;Butanedioic acid diamide |
Molekulare Formel | C4H8N2O2 |
Molecular Weight | 116.1185 |
InChl | InChI=1/C4H8N2O2/c5-3(7)1-2-4(6)8/h1-2H2,(H2,5,7)(H2,6,8) |
CAS Registry Number | 110-14-5 |
EINECS | 203-739-9 |
Molecular Structure | |
Dichte | 1.207g/cm3 |
Schmelzpunkt | 260-265℃ |
Siedepunkt | 494°C at 760 mmHg |
Brechungsindex | 1.488 |
Flammpunkt | 252.6°C |
Dampfdruck | 6.7E-10mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |