ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
Produkt-Name | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Englischer Name | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
Molekulare Formel | C8H16O2 |
Molecular Weight | 144.2114 |
InChl | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS Registry Number | 105-08-8 |
EINECS | 203-268-9 |
Molecular Structure | |
Dichte | 1.004g/cm3 |
Schmelzpunkt | 31.5℃ |
Siedepunkt | 286.2°C at 760 mmHg |
Brechungsindex | 1.47 |
Flammpunkt | 161.1°C |
Wasserlöslichkeit | miscible |
Dampfdruck | 0.000303mmHg at 25°C |
Risk Codes | R36:; |
Safety Beschreibung | S26||S39:; |
MSDS |