ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-45-0 1-Methoxy-4-propylbenzol |
|
Produkt-Name | 1-Methoxy-4-propylbenzol |
Synonyme | 4-Propylanisol = Dihydroanethol = p-Propylanisol; 4-n-Propylanisol; |
Englischer Name | 1-Methoxy-4-propylbenzene;4-Propylanisole = Dihydroanethole = p-Propylanisole;4-n-Propylanisole |
Molekulare Formel | C10H14O |
Molecular Weight | 150.2176 |
InChl | InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
CAS Registry Number | 104-45-0 |
EINECS | 203-203-4 |
Molecular Structure | |
Dichte | 0.922g/cm3 |
Siedepunkt | 211.4°C at 760 mmHg |
Brechungsindex | 1.49 |
Flammpunkt | 82.3°C |
Dampfdruck | 0.266mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |