ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-94-6 4-Nitrophenyloxamic acid |
|
Produkt-Name | 4-Nitrophenyloxamic acid |
Englischer Name | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
Molekulare Formel | C8H6N2O5 |
Molecular Weight | 210.1436 |
InChl | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
CAS Registry Number | 103-94-6 |
EINECS | 203-160-1 |
Molecular Structure | |
Dichte | 1.629g/cm3 |
Brechungsindex | 1.678 |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |